C18H26N4 — CID 167173118
8-methyl-11-propan-2-yl-5-pyrrolidin-1-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167173118) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 8-methyl-11-propan-2-yl-5-pyrrolidin-1-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 8-methyl-11-propan-2-yl-5-pyrrolidin-1-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167173118 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 8-methyl-11-propan-2-yl-5-pyrrolidin-1-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | Cc1c2n(c3ncc(N4CCCC4)cc13)CCN(C(C)C)C2 |
| InChI | InChI=1S/C18H26N4/c1-13(2)21-8-9-22-17(12-21)14(3)16-10-15(11-19-18(16)22)20-6-4-5-7-20/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | MEVKJGXFBOPIIH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |