C16H20O7S — CID 16719814
(1S,2R,6R,8R,11R)-11-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 16719814) has the molecular formula C16H20O7S and a molecular weight of 356.40 g/mol. Its IUPAC name is (1S,2R,6R,8R,11R)-11-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,11R)-11-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 16719814 |
| Molecular Formula | C16H20O7S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (1S,2R,6R,8R,11R)-11-(benzenesulfonylmethyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CO[C@@H](CS(=O)(=O)c4ccccc4)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C16H20O7S/c1-16(2)22-14-13-11(20-15(14)23-16)8-19-12(21-13)9-24(17,18)10-6-4-3-5-7-10/h3-7,11-15H,8-9H2,1-2H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | IHOCFJGRHLXJGO-UXXRCYHCSA-N |
| XLogP | 1.08 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |