C6H15NO3S — CID 167221941
2-(propan-2-ylamino)ethoxymethanesulfinic acid (PubChem CID 167221941) has the molecular formula C6H15NO3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-(propan-2-ylamino)ethoxymethanesulfinic acid.
| Compound Name | 2-(propan-2-ylamino)ethoxymethanesulfinic acid |
|---|---|
| PubChem CID | 167221941 |
| Molecular Formula | C6H15NO3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 2-(propan-2-ylamino)ethoxymethanesulfinic acid |
| SMILES | CC(C)NCCOCS(=O)O |
| InChI | InChI=1S/C6H15NO3S/c1-6(2)7-3-4-10-5-11(8)9/h6-7H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | LCGIERCVWFRBIO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|