C13H12O2 — CID 167229957
(E)-3-(6,7-dihydronaphthalen-2-yl)prop-2-enoic acid (PubChem CID 167229957) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (E)-3-(6,7-dihydronaphthalen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6,7-dihydronaphthalen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 167229957 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (E)-3-(6,7-dihydronaphthalen-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)=CCCC=2 |
| InChI | InChI=1S/C13H12O2/c14-13(15)8-6-10-5-7-11-3-1-2-4-12(11)9-10/h3-9H,1-2H2,(H,14,15)/b8-6+ |
| InChIKey | MMHSQRUHTYZBKV-SOFGYWHQSA-N |
| XLogP | 1.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|