C37H35N3O9 — CID 16723352
2-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(2-methoxybenzoyl)-1,2,4-triazine-3,5-dione (PubChem CID 16723352) has the molecular formula C37H35N3O9 and a molecular weight of 665.70 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(2-methoxybenzoyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(2-methoxybenzoyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 16723352 |
| Molecular Formula | C37H35N3O9 |
| Molecular Weight | 665.70 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | 2-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(2-methoxybenzoyl)-1,2,4-triazine-3,5-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ncc(=O)n(C(=O)c4ccccc4OC)c3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H35N3O9/c1-45-27-17-13-25(14-18-27)37(24-9-5-4-6-10-24,26-15-19-28(46-2)20-16-26)48-23-32-30(41)21-34(49-32)40-36(44)39(33(42)22-38-40)35(43)29-11-7-8-12-31(29)47-3/h4-20,22,30,32,34,41H,21,23H2,1-3H3/t30-,32+,34+/m0/s1 |
| InChIKey | OGWQNWKXZCVKLU-DEIXXNFJSA-N |
| XLogP | 3.78 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|