C43H65N2O10P — CID 167244409
N-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-(3-methyliminopropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 167244409) has the molecular formula C43H65N2O10P and a molecular weight of 800.97 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-(3-methyliminopropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-(3-methyliminopropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 167244409 |
| Molecular Formula | C43H65N2O10P |
| Molecular Weight | 800.97 g/mol |
| Exact Mass | 800.44 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-(3-methyliminopropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | C/N=C/CCOP(OCCOCCOCCOCCOCCOCCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C43H65N2O10P/c1-36(2)45(37(3)4)56(54-23-11-22-44-5)55-35-33-52-31-29-50-27-25-48-24-26-49-28-30-51-32-34-53-43(38-12-9-8-10-13-38,39-14-18-41(46-6)19-15-39)40-16-20-42(47-7)21-17-40/h8-10,12-22,36-37H,11,23-35H2,1-7H3/b44-22+ |
| InChIKey | VSPNIQPLUNXPOO-QWJCYBNYSA-N |
| XLogP | 7.56 |
| TPSA | 107.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.97 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|