C37H48NO6P — CID 166895211
N-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-prop-2-ynoxypropoxy]-but-3-enoxyphosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 166895211) has the molecular formula C37H48NO6P and a molecular weight of 633.77 g/mol. Its IUPAC name is N-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-prop-2-ynoxypropoxy]-but-3-enoxyphosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-prop-2-ynoxypropoxy]-but-3-enoxyphosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 166895211 |
| Molecular Formula | C37H48NO6P |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | N-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-prop-2-ynoxypropoxy]-but-3-enoxyphosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | C#CCOC(COP(OCCC=C)N(C(C)C)C(C)C)COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C37H48NO6P/c1-9-11-26-43-45(38(29(3)4)30(5)6)44-28-36(41-25-10-2)27-42-37(31-15-13-12-14-16-31,32-17-21-34(39-7)22-18-32)33-19-23-35(40-8)24-20-33/h2,9,12-24,29-30,36H,1,11,25-28H2,3-8H3 |
| InChIKey | ZYYYSQHRFHFSSY-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|