C32H34O9S2 — CID 167250725
4-[4-[2-[[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfonylphenoxy]methoxymethoxy]propan-2-yl]phenyl]sulfonylphenol (PubChem CID 167250725) has the molecular formula C32H34O9S2 and a molecular weight of 626.75 g/mol. Its IUPAC name is 4-[4-[2-[[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfonylphenoxy]methoxymethoxy]propan-2-yl]phenyl]sulfonylphenol.
| Compound Name | 4-[4-[2-[[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfonylphenoxy]methoxymethoxy]propan-2-yl]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 167250725 |
| Molecular Formula | C32H34O9S2 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 4-[4-[2-[[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfonylphenoxy]methoxymethoxy]propan-2-yl]phenyl]sulfonylphenol |
| SMILES | CC(C)(O)c1ccc(S(=O)(=O)c2ccc(OCOCOC(C)(C)c3ccc(S(=O)(=O)c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O9S2/c1-31(2,34)23-5-13-27(14-6-23)43(37,38)30-19-11-26(12-20-30)40-21-39-22-41-32(3,4)24-7-15-28(16-8-24)42(35,36)29-17-9-25(33)10-18-29/h5-20,33-34H,21-22H2,1-4H3 |
| InChIKey | IUAQPJBMWIVGAC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|