C19H13N — CID 167253368
(10Z)-10-[(Z)-pent-2-en-4-ynylidene]-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,11,13-hexaene (PubChem CID 167253368) has the molecular formula C19H13N and a molecular weight of 255.32 g/mol. Its IUPAC name is (10Z)-10-[(Z)-pent-2-en-4-ynylidene]-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,11,13-hexaene.
| Compound Name | (10Z)-10-[(Z)-pent-2-en-4-ynylidene]-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,11,13-hexaene |
|---|---|
| PubChem CID | 167253368 |
| Molecular Formula | C19H13N |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (10Z)-10-[(Z)-pent-2-en-4-ynylidene]-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,11,13-hexaene |
| SMILES | C#C/C=C\C=C1/Cn2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C19H13N/c1-2-3-4-8-14-13-20-18-12-6-5-9-16(18)17-11-7-10-15(14)19(17)20/h1,3-12H,13H2/b4-3-,14-8+ |
| InChIKey | JKXUHHOZGBNSIY-ZEFAFFGOSA-N |
| XLogP | 4.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|