C14H11N3 — CID 102253898
1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-amine (PubChem CID 102253898) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-amine.
| Compound Name | 1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-amine |
|---|---|
| PubChem CID | 102253898 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-amine |
| SMILES | NC1=Nc2cccc3c4ccccc4n(c23)C1 |
| InChI | InChI=1S/C14H11N3/c15-13-8-17-12-7-2-1-4-9(12)10-5-3-6-11(16-13)14(10)17/h1-7H,8H2,(H2,15,16) |
| InChIKey | LWSXUMUFBCUGJX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |