About 1-iodocarbazol-9-amine
1-iodocarbazol-9-amine (PubChem CID 134389123) has the molecular formula C12H9IN2
and a molecular weight of 308.12 g/mol. Its IUPAC name is 1-iodocarbazol-9-amine.
Molecular Properties
| Compound Name | 1-iodocarbazol-9-amine |
| PubChem CID | 134389123 |
| Molecular Formula | C12H9IN2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 1-iodocarbazol-9-amine |
| SMILES | Nn1c2ccccc2c2cccc(I)c21 |
| InChI | InChI=1S/C12H9IN2/c13-10-6-3-5-9-8-4-1-2-7-11(8)15(14)12(9)10/h1-7H,14H2 |
| InChIKey | WQCROLUUFIDKOQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodocarbazol-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodocarbazol-9-amine?
The IUPAC name of 1-iodocarbazol-9-amine (CID 134389123) is 1-iodocarbazol-9-amine.
What is the SMILES notation for 1-iodocarbazol-9-amine?
The canonical SMILES for 1-iodocarbazol-9-amine is Nn1c2ccccc2c2cccc(I)c21.
What is the InChIKey of 1-iodocarbazol-9-amine?
The InChIKey is WQCROLUUFIDKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9IN2/c13-10-6-3-5-9-8-4-1-2-7-11(8)15(14)12(9)10/h1-7H,14H2.
What are the key properties of 1-iodocarbazol-9-amine?
1-iodocarbazol-9-amine has a molecular weight of 308.12 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodocarbazol-9-amine is sourced from PubChem (CID 134389123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).