C25H48O3Si — CID 16726292
(2S)-1-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]pent-4-en-2-ol (PubChem CID 16726292) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is (2S)-1-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]pent-4-en-2-ol.
| Compound Name | (2S)-1-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 16726292 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | (2S)-1-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C[C@H]1O[C@H](C[C@H](/C=C/CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C25H48O3Si/c1-10-12-21(26)17-24-20(4)15-16-22(27-24)18-23(14-11-13-19(2)3)28-29(8,9)25(5,6)7/h10-11,14,19-24,26H,1,12-13,15-18H2,2-9H3/b14-11+/t20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | CALVANRRGACBTI-MTAMFMMBSA-N |
| XLogP | 6.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|