C56H74Cl4O8 — CID 167265644
tris(2-ethylhexyl) 1,6,7,12-tetrachloro-10-[2-ethylhexoxy(hydroxy)methyl]perylene-3,4,9-tricarboxylate (PubChem CID 167265644) has the molecular formula C56H74Cl4O8 and a molecular weight of 1017.01 g/mol. Its IUPAC name is tris(2-ethylhexyl) 1,6,7,12-tetrachloro-10-[2-ethylhexoxy(hydroxy)methyl]perylene-3,4,9-tricarboxylate.
| Compound Name | tris(2-ethylhexyl) 1,6,7,12-tetrachloro-10-[2-ethylhexoxy(hydroxy)methyl]perylene-3,4,9-tricarboxylate |
|---|---|
| PubChem CID | 167265644 |
| Molecular Formula | C56H74Cl4O8 |
| Molecular Weight | 1017.01 g/mol |
| Exact Mass | 1014.41 |
| IUPAC Name | tris(2-ethylhexyl) 1,6,7,12-tetrachloro-10-[2-ethylhexoxy(hydroxy)methyl]perylene-3,4,9-tricarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc(Cl)c2c3c(Cl)cc(C(=O)OCC(CC)CCCC)c4c(C(O)OCC(CC)CCCC)cc(Cl)c(c5c(Cl)cc(C(=O)OCC(CC)CCCC)c1c25)c43 |
| InChI | InChI=1S/C56H74Cl4O8/c1-9-17-21-33(13-5)29-65-53(61)37-25-41(57)47-49-43(59)27-39(55(63)67-31-35(15-7)23-19-11-3)46-40(56(64)68-32-36(16-8)24-20-12-4)28-44(60)50(52(46)49)48-42(58)26-38(45(37)51(47)48)54(62)66-30-34(14-6)22-18-10-2/h25-28,33-36,53,61H,9-24,29-32H2,1-8H3 |
| InChIKey | SOVJPVVIZJCFCS-UHFFFAOYSA-N |
| XLogP | 17.69 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.01 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|