C22H44N2O2 — CID 167269909
2-methyl-2-(5-methylhexoxy)-N-[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]propanamide (PubChem CID 167269909) has the molecular formula C22H44N2O2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 2-methyl-2-(5-methylhexoxy)-N-[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]propanamide.
| Compound Name | 2-methyl-2-(5-methylhexoxy)-N-[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 167269909 |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | 2-methyl-2-(5-methylhexoxy)-N-[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]propanamide |
| SMILES | CNCC1(C)CC(NC(=O)C(C)(C)OCCCCC(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C22H44N2O2/c1-17(2)11-9-10-12-26-21(5,6)19(25)24-18-13-20(3,4)15-22(7,14-18)16-23-8/h17-18,23H,9-16H2,1-8H3,(H,24,25) |
| InChIKey | RCCMUHMVXDMSKH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|