C15H23F2N — CID 167272852
(1S)-N-ethyl-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-amine (PubChem CID 167272852) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is (1S)-N-ethyl-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-amine.
| Compound Name | (1S)-N-ethyl-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 167272852 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (1S)-N-ethyl-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-amine |
| SMILES | C=C(/C=C\C=C/C)[C@@]1(NCC)CCCCC1(F)F |
| InChI | InChI=1S/C15H23F2N/c1-4-6-7-10-13(3)14(18-5-2)11-8-9-12-15(14,16)17/h4,6-7,10,18H,3,5,8-9,11-12H2,1-2H3/b6-4-,10-7-/t14-/m0/s1 |
| InChIKey | LROXIGQGLOFBIV-PSCDNXMCSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|