C22H4F4N6O2 — CID 167273996
3,7-bis(dicyanomethylidene)-4,8-bis(difluoromethoxy)-s-indacene-1,5-dicarbonitrile (PubChem CID 167273996) has the molecular formula C22H4F4N6O2 and a molecular weight of 460.31 g/mol. Its IUPAC name is 3,7-bis(dicyanomethylidene)-4,8-bis(difluoromethoxy)-s-indacene-1,5-dicarbonitrile.
| Compound Name | 3,7-bis(dicyanomethylidene)-4,8-bis(difluoromethoxy)-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 167273996 |
| Molecular Formula | C22H4F4N6O2 |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 3,7-bis(dicyanomethylidene)-4,8-bis(difluoromethoxy)-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC1=CC(=C(C#N)C#N)c2c(OC(F)F)c3c(c(OC(F)F)c21)C(=C(C#N)C#N)C=C3C#N |
| InChI | InChI=1S/C22H4F4N6O2/c23-21(24)33-19-15-9(3-27)1-13(11(5-29)6-30)17(15)20(34-22(25)26)16-10(4-28)2-14(18(16)19)12(7-31)8-32/h1-2,21-22H |
| InChIKey | JXQIMIKYPPPJNH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 161.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|