C16H14F2N6O2 — CID 16728891
N-[(2,5-difluorophenyl)methyl]-4-methyl-6-(2-methylimidazol-1-yl)-5-nitropyrimidin-2-amine (PubChem CID 16728891) has the molecular formula C16H14F2N6O2 and a molecular weight of 360.32 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-methyl-6-(2-methylimidazol-1-yl)-5-nitropyrimidin-2-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-methyl-6-(2-methylimidazol-1-yl)-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 16728891 |
| Molecular Formula | C16H14F2N6O2 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-methyl-6-(2-methylimidazol-1-yl)-5-nitropyrimidin-2-amine |
| SMILES | Cc1nc(NCc2cc(F)ccc2F)nc(-n2ccnc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14F2N6O2/c1-9-14(24(25)26)15(23-6-5-19-10(23)2)22-16(21-9)20-8-11-7-12(17)3-4-13(11)18/h3-7H,8H2,1-2H3,(H,20,21,22) |
| InChIKey | BLJAYBGXTUSGSN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|