C21H27N5O — CID 167300182
5-N-[4-(2,6-dimethylmorpholin-4-yl)-2-methylphenyl]-1-methylbenzimidazole-2,5-diamine (PubChem CID 167300182) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 5-N-[4-(2,6-dimethylmorpholin-4-yl)-2-methylphenyl]-1-methylbenzimidazole-2,5-diamine.
| Compound Name | 5-N-[4-(2,6-dimethylmorpholin-4-yl)-2-methylphenyl]-1-methylbenzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 167300182 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 5-N-[4-(2,6-dimethylmorpholin-4-yl)-2-methylphenyl]-1-methylbenzimidazole-2,5-diamine |
| SMILES | Cc1cc(N2CC(C)OC(C)C2)ccc1Nc1ccc2c(c1)nc(N)n2C |
| InChI | InChI=1S/C21H27N5O/c1-13-9-17(26-11-14(2)27-15(3)12-26)6-7-18(13)23-16-5-8-20-19(10-16)24-21(22)25(20)4/h5-10,14-15,23H,11-12H2,1-4H3,(H2,22,24) |
| InChIKey | SVFQLLMNQYFTSD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|