C22H25F4N3O — CID 167300614
N-[[4-[3-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2-methylphenyl]methyl]-N-methylformamide (PubChem CID 167300614) has the molecular formula C22H25F4N3O and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[[4-[3-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2-methylphenyl]methyl]-N-methylformamide.
| Compound Name | N-[[4-[3-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2-methylphenyl]methyl]-N-methylformamide |
|---|---|
| PubChem CID | 167300614 |
| Molecular Formula | C22H25F4N3O |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[[4-[3-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2-methylphenyl]methyl]-N-methylformamide |
| SMILES | Cc1cc(Nc2ccc(N3CCC(C(F)(F)F)CC3)c(F)c2)ccc1CN(C)C=O |
| InChI | InChI=1S/C22H25F4N3O/c1-15-11-18(4-3-16(15)13-28(2)14-30)27-19-5-6-21(20(23)12-19)29-9-7-17(8-10-29)22(24,25)26/h3-6,11-12,14,17,27H,7-10,13H2,1-2H3 |
| InChIKey | LIVIMWJMXYTUCU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|