C26H26NO3+ — CID 167317279
4-(2,2-dimethylpropyl)-1-methyl-2-(8-methyl-[1]benzofuro[3,2-b][1,4]benzodioxin-7-yl)pyridin-1-ium (PubChem CID 167317279) has the molecular formula C26H26NO3+ and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methyl-2-(8-methyl-[1]benzofuro[3,2-b][1,4]benzodioxin-7-yl)pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(8-methyl-[1]benzofuro[3,2-b][1,4]benzodioxin-7-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167317279 |
| Molecular Formula | C26H26NO3+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(8-methyl-[1]benzofuro[3,2-b][1,4]benzodioxin-7-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c3c(oc2c1-c1cc(CC(C)(C)C)cc[n+]1C)Oc1ccccc1O3 |
| InChI | InChI=1S/C26H26NO3/c1-16-10-11-18-23(30-25-24(18)28-20-8-6-7-9-21(20)29-25)22(16)19-14-17(12-13-27(19)5)15-26(2,3)4/h6-14H,15H2,1-5H3/q+1 |
| InChIKey | VJJHYDBNCVDVKI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 35.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|