C20H20FNO4 — CID 167321650
(2-but-2-ynoxy-1,3-dioxolan-2-yl)-[3-fluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]methanone (PubChem CID 167321650) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is (2-but-2-ynoxy-1,3-dioxolan-2-yl)-[3-fluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]methanone.
| Compound Name | (2-but-2-ynoxy-1,3-dioxolan-2-yl)-[3-fluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 167321650 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2-but-2-ynoxy-1,3-dioxolan-2-yl)-[3-fluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]methanone |
| SMILES | CC#CCOC1(C(=O)c2c(F)ccn2[C@H](C)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C20H20FNO4/c1-3-4-12-24-20(25-13-14-26-20)19(23)18-17(21)10-11-22(18)15(2)16-8-6-5-7-9-16/h5-11,15H,12-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | NCXDTKQYOCJGQL-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|