C16H32O3Si — CID 16732244
2-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]acetaldehyde (PubChem CID 16732244) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is 2-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]acetaldehyde.
| Compound Name | 2-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 16732244 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]acetaldehyde |
| SMILES | CC[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](CC=O)[C@@H]1C |
| InChI | InChI=1S/C16H32O3Si/c1-9-13-12(2)14(10-11-17)19-20(18-13,15(3,4)5)16(6,7)8/h11-14H,9-10H2,1-8H3/t12-,13-,14-/m1/s1 |
| InChIKey | YGGMGCCRFCWIOF-MGPQQGTHSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|