C26H46N4O9 — CID 167328015
3-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethylamino)-N,N-bis[2-(prop-2-enoylamino)ethyl]propanamide (PubChem CID 167328015) has the molecular formula C26H46N4O9 and a molecular weight of 558.67 g/mol. Its IUPAC name is 3-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethylamino)-N,N-bis[2-(prop-2-enoylamino)ethyl]propanamide.
| Compound Name | 3-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethylamino)-N,N-bis[2-(prop-2-enoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 167328015 |
| Molecular Formula | C26H46N4O9 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 3-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethylamino)-N,N-bis[2-(prop-2-enoylamino)ethyl]propanamide |
| SMILES | C=CC(=O)NCCN(CCNC(=O)C=C)C(=O)CCNCC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C26H46N4O9/c1-3-24(31)28-7-9-30(10-8-29-25(32)4-2)26(33)5-6-27-21-23-22-38-18-17-36-14-13-34-11-12-35-15-16-37-19-20-39-23/h3-4,23,27H,1-2,5-22H2,(H,28,31)(H,29,32) |
| InChIKey | CVAMOCASHQTJHS-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|