C23H27N7O2 — CID 167335205
4-[5-(4-amino-2-ethyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-cyclopropyl-2-methoxybenzamide (PubChem CID 167335205) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 4-[5-(4-amino-2-ethyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-cyclopropyl-2-methoxybenzamide.
| Compound Name | 4-[5-(4-amino-2-ethyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-cyclopropyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 167335205 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-[5-(4-amino-2-ethyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-cyclopropyl-2-methoxybenzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc(C(=O)NC4CC4)c(OC)c3)nn2C)c1CC |
| InChI | InChI=1S/C23H27N7O2/c1-4-15-17(12-24)18(25)9-10-19(15)27-23-28-21(29-30(23)2)13-5-8-16(20(11-13)32-3)22(31)26-14-6-7-14/h5,8-12,14,24H,4,6-7,25H2,1-3H3,(H,26,31)(H,27,28,29)/b24-12+ |
| InChIKey | QJCKJVKDONKMTA-WYMPLXKRSA-N |
| XLogP | 3.27 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|