C22H28N8O2 — CID 166883904
4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[2-(methylamino)ethyl]benzamide (PubChem CID 166883904) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 166883904 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[2-(methylamino)ethyl]benzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc(C(=O)NCCNC)c(OC)c3)nn2C)c1C |
| InChI | InChI=1S/C22H28N8O2/c1-13-16(12-23)17(24)7-8-18(13)27-22-28-20(29-30(22)3)14-5-6-15(19(11-14)32-4)21(31)26-10-9-25-2/h5-8,11-12,23,25H,9-10,24H2,1-4H3,(H,26,31)(H,27,28,29)/b23-12+ |
| InChIKey | PVVHDHKRGDVQTD-FSJBWODESA-N |
| XLogP | 2.07 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|