C24H28F3N7O2 — CID 155792171
4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-(2-methylpropyl)-1,2,4-triazol-3-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 155792171) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-(2-methylpropyl)-1,2,4-triazol-3-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-(2-methylpropyl)-1,2,4-triazol-3-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 155792171 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 4-[5-(4-amino-3-methanimidoyl-2-methylanilino)-1-(2-methylpropyl)-1,2,4-triazol-3-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc(C(=O)NCC(F)(F)F)c(OC)c3)nn2CC(C)C)c1C |
| InChI | InChI=1S/C24H28F3N7O2/c1-13(2)11-34-23(31-19-8-7-18(29)17(10-28)14(19)3)32-21(33-34)15-5-6-16(20(9-15)36-4)22(35)30-12-24(25,26)27/h5-10,13,28H,11-12,29H2,1-4H3,(H,30,35)(H,31,32,33)/b28-10+ |
| InChIKey | WRXSFUZMUJBBTM-ORBVJSQLSA-N |
| XLogP | 4.53 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|