C22H25N7O — CID 166883955
4-[5-(4-amino-2-cyclopropyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-ethylbenzamide (PubChem CID 166883955) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[5-(4-amino-2-cyclopropyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-ethylbenzamide.
| Compound Name | 4-[5-(4-amino-2-cyclopropyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 166883955 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-[5-(4-amino-2-cyclopropyl-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-ethylbenzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc(C(=O)NCC)cc3)nn2C)c1C1CC1 |
| InChI | InChI=1S/C22H25N7O/c1-3-25-21(30)15-8-6-14(7-9-15)20-27-22(29(2)28-20)26-18-11-10-17(24)16(12-23)19(18)13-4-5-13/h6-13,23H,3-5,24H2,1-2H3,(H,25,30)(H,26,27,28)/b23-12+ |
| InChIKey | JEEQLIOWUOTASQ-FSJBWODESA-N |
| XLogP | 3.43 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|