C20H20F3N7O2 — CID 167335183
4-[3-(4-amino-3-methanimidoyl-2-methylanilino)-1H-1,2,4-triazol-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 167335183) has the molecular formula C20H20F3N7O2 and a molecular weight of 447.42 g/mol. Its IUPAC name is 4-[3-(4-amino-3-methanimidoyl-2-methylanilino)-1H-1,2,4-triazol-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[3-(4-amino-3-methanimidoyl-2-methylanilino)-1H-1,2,4-triazol-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 167335183 |
| Molecular Formula | C20H20F3N7O2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-[3-(4-amino-3-methanimidoyl-2-methylanilino)-1H-1,2,4-triazol-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2n[nH]c(-c3ccc(C(=O)NCC(F)(F)F)c(OC)c3)n2)c1C |
| InChI | InChI=1S/C20H20F3N7O2/c1-10-13(8-24)14(25)5-6-15(10)27-19-28-17(29-30-19)11-3-4-12(16(7-11)32-2)18(31)26-9-20(21,22)23/h3-8,24H,9,25H2,1-2H3,(H,26,31)(H2,27,28,29,30)/b24-8+ |
| InChIKey | LGRFQTJTQINGFE-KTZMUZOWSA-N |
| XLogP | 3.40 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|