C13H14N2O4 — CID 167337487
1-[(1R)-1-methylcyclohex-2-en-1-yl]-3,5-dinitrobenzene (PubChem CID 167337487) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 1-[(1R)-1-methylcyclohex-2-en-1-yl]-3,5-dinitrobenzene.
| Compound Name | 1-[(1R)-1-methylcyclohex-2-en-1-yl]-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 167337487 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-[(1R)-1-methylcyclohex-2-en-1-yl]-3,5-dinitrobenzene |
| SMILES | C[C@]1(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C=CCCC1 |
| InChI | InChI=1S/C13H14N2O4/c1-13(5-3-2-4-6-13)10-7-11(14(16)17)9-12(8-10)15(18)19/h3,5,7-9H,2,4,6H2,1H3/t13-/m0/s1 |
| InChIKey | QKMWFKLNDGFOQW-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|