C16H13N5 — CID 167350599
[3-(1,5-naphthyridin-2-yl)-2H-indazol-7-yl]methanamine (PubChem CID 167350599) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is [3-(1,5-naphthyridin-2-yl)-2H-indazol-7-yl]methanamine.
| Compound Name | [3-(1,5-naphthyridin-2-yl)-2H-indazol-7-yl]methanamine |
|---|---|
| PubChem CID | 167350599 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [3-(1,5-naphthyridin-2-yl)-2H-indazol-7-yl]methanamine |
| SMILES | NCc1cccc2c(-c3ccc4ncccc4n3)[nH]nc12 |
| InChI | InChI=1S/C16H13N5/c17-9-10-3-1-4-11-15(10)20-21-16(11)14-7-6-12-13(19-14)5-2-8-18-12/h1-8H,9,17H2,(H,20,21) |
| InChIKey | BHTZRLCBJYWPJW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |