C42H50N4S5 — CID 167359382
4,7-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-5-N,5-N,6-N,6-N-tetramethyl-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 167359382) has the molecular formula C42H50N4S5 and a molecular weight of 771.23 g/mol. Its IUPAC name is 4,7-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-5-N,5-N,6-N,6-N-tetramethyl-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-5-N,5-N,6-N,6-N-tetramethyl-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 167359382 |
| Molecular Formula | C42H50N4S5 |
| Molecular Weight | 771.23 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | 4,7-bis[2-(4-ethyloct-1-ynyl)thieno[3,2-b]thiophen-5-yl]-5-N,5-N,6-N,6-N-tetramethyl-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | CCCCC(CC)CC#Cc1cc2sc(-c3c(N(C)C)c(N(C)C)c(-c4cc5sc(C#CCC(CC)CCCC)cc5s4)c4nsnc34)cc2s1 |
| InChI | InChI=1S/C42H50N4S5/c1-9-13-17-27(11-3)19-15-21-29-23-31-33(47-29)25-35(49-31)37-39-40(44-51-43-39)38(42(46(7)8)41(37)45(5)6)36-26-34-32(50-36)24-30(48-34)22-16-20-28(12-4)18-14-10-2/h23-28H,9-14,17-20H2,1-8H3 |
| InChIKey | GOENLCALJOSHOI-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.23 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|