C38H40S6 — CID 122393562
2,8-bis[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-4λ4,10λ4-dithiatricyclo[7.3.0.03,7]dodeca-1,3,4,5,7,9,10,11-octaene (PubChem CID 122393562) has the molecular formula C38H40S6 and a molecular weight of 689.14 g/mol. Its IUPAC name is 2,8-bis[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-4λ4,10λ4-dithiatricyclo[7.3.0.03,7]dodeca-1,3,4,5,7,9,10,11-octaene.
| Compound Name | 2,8-bis[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-4λ4,10λ4-dithiatricyclo[7.3.0.03,7]dodeca-1,3,4,5,7,9,10,11-octaene |
|---|---|
| PubChem CID | 122393562 |
| Molecular Formula | C38H40S6 |
| Molecular Weight | 689.14 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | 2,8-bis[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-4λ4,10λ4-dithiatricyclo[7.3.0.03,7]dodeca-1,3,4,5,7,9,10,11-octaene |
| SMILES | CCCCC(CC)Cc1cc2sc(-c3c4c(c(-c5cc6sc(CC(CC)CCCC)cc6s5)c5c3=S=C=C5)=S=C=C4)cc2s1 |
| InChI | InChI=1S/C38H40S6/c1-5-9-11-23(7-3)17-25-19-29-31(41-25)21-33(43-29)35-27-13-15-40-38(27)36(28-14-16-39-37(28)35)34-22-32-30(44-34)20-26(42-32)18-24(8-4)12-10-6-2/h13-14,19-24H,5-12,17-18H2,1-4H3 |
| InChIKey | KXSAKTRICOUAAS-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.14 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|