C24H25ClN4O5 — CID 16736320
4-[2-amino-3-chloro-4-(cyclopropylamino)-5-formylphenoxy]-7-(2-methoxyethoxy)-N-methylquinoline-6-carboxamide (PubChem CID 16736320) has the molecular formula C24H25ClN4O5 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-[2-amino-3-chloro-4-(cyclopropylamino)-5-formylphenoxy]-7-(2-methoxyethoxy)-N-methylquinoline-6-carboxamide.
| Compound Name | 4-[2-amino-3-chloro-4-(cyclopropylamino)-5-formylphenoxy]-7-(2-methoxyethoxy)-N-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 16736320 |
| Molecular Formula | C24H25ClN4O5 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-[2-amino-3-chloro-4-(cyclopropylamino)-5-formylphenoxy]-7-(2-methoxyethoxy)-N-methylquinoline-6-carboxamide |
| SMILES | CNC(=O)c1cc2c(Oc3cc(C=O)c(NC4CC4)c(Cl)c3N)ccnc2cc1OCCOC |
| InChI | InChI=1S/C24H25ClN4O5/c1-27-24(31)16-10-15-17(11-19(16)33-8-7-32-2)28-6-5-18(15)34-20-9-13(12-30)23(21(25)22(20)26)29-14-3-4-14/h5-6,9-12,14,29H,3-4,7-8,26H2,1-2H3,(H,27,31) |
| InChIKey | GGWMQTZTBSJVDP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|