C23H23N — CID 167379526
9-[(2-tert-butyl-3,4,5,6-tetradeuteriophenyl)methyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole (PubChem CID 167379526) has the molecular formula C23H23N and a molecular weight of 325.52 g/mol. Its IUPAC name is 9-[(2-tert-butyl-3,4,5,6-tetradeuteriophenyl)methyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole.
| Compound Name | 9-[(2-tert-butyl-3,4,5,6-tetradeuteriophenyl)methyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
|---|---|
| PubChem CID | 167379526 |
| Molecular Formula | C23H23N |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 9-[(2-tert-butyl-3,4,5,6-tetradeuteriophenyl)methyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(C(C)(C)C)c(Cn2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C23H23N/c1-23(2,3)20-13-7-4-10-17(20)16-24-21-14-8-5-11-18(21)19-12-6-9-15-22(19)24/h4-15H,16H2,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D |
| InChIKey | MKHCJUVMQIETQG-LBBHMSQHSA-N |
| XLogP | 6.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |