C22H28 — CID 167379549
1-tert-butyl-2,3,4,5,6,7,8-heptadeuterio-9,9,10,10-tetramethylanthracene (PubChem CID 167379549) has the molecular formula C22H28 and a molecular weight of 299.51 g/mol. Its IUPAC name is 1-tert-butyl-2,3,4,5,6,7,8-heptadeuterio-9,9,10,10-tetramethylanthracene.
| Compound Name | 1-tert-butyl-2,3,4,5,6,7,8-heptadeuterio-9,9,10,10-tetramethylanthracene |
|---|---|
| PubChem CID | 167379549 |
| Molecular Formula | C22H28 |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1-tert-butyl-2,3,4,5,6,7,8-heptadeuterio-9,9,10,10-tetramethylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])C(C)(C)c1c([2H])c([2H])c([2H])c(C(C)(C)C)c1C2(C)C |
| InChI | InChI=1S/C22H28/c1-20(2,3)17-13-10-14-18-19(17)22(6,7)16-12-9-8-11-15(16)21(18,4)5/h8-14H,1-7H3/i8D,9D,10D,11D,12D,13D,14D |
| InChIKey | NLNOTWGFWCDCSY-RQSBUPHTSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |