C37H41BN4O8 — CID 167387204
3-[7-[3-[2-[2-[2-[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)methyl]-4-isocyanophenyl]ethoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167387204) has the molecular formula C37H41BN4O8 and a molecular weight of 680.57 g/mol. Its IUPAC name is 3-[7-[3-[2-[2-[2-[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)methyl]-4-isocyanophenyl]ethoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-[2-[2-[2-[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)methyl]-4-isocyanophenyl]ethoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167387204 |
| Molecular Formula | C37H41BN4O8 |
| Molecular Weight | 680.57 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | 3-[7-[3-[2-[2-[2-[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)methyl]-4-isocyanophenyl]ethoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [C-]#[N+]c1ccc(CCOCCOCCOCCCNc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)c(Cc2ccc3c(c2)COB3O)c1 |
| InChI | InChI=1S/C37H41BN4O8/c1-39-29-8-7-26(27(22-29)20-25-6-9-32-28(21-25)24-50-38(32)46)12-15-48-17-19-49-18-16-47-14-3-13-40-33-5-2-4-30-31(33)23-42(37(30)45)34-10-11-35(43)41-36(34)44/h2,4-9,21-22,34,40,46H,3,10-20,23-24H2,(H,41,43,44) |
| InChIKey | OFFJIZXPRYVLFK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|