C22H16O4 — CID 167404706
2-(5-benzyl-4,6-dioxocyclohexen-1-yl)indene-1,3-dione (PubChem CID 167404706) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-(5-benzyl-4,6-dioxocyclohexen-1-yl)indene-1,3-dione.
| Compound Name | 2-(5-benzyl-4,6-dioxocyclohexen-1-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 167404706 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(5-benzyl-4,6-dioxocyclohexen-1-yl)indene-1,3-dione |
| SMILES | O=C1CC=C(C2C(=O)c3ccccc3C2=O)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H16O4/c23-18-11-10-16(20(24)17(18)12-13-6-2-1-3-7-13)19-21(25)14-8-4-5-9-15(14)22(19)26/h1-10,17,19H,11-12H2 |
| InChIKey | RJUUHMXTVSSNAO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|