C22H36O6 — CID 167425407
3-(3,7-dihydroxy-3,7-dimethyloctyl)-2,4-dihydroxy-6-pentylbenzoic acid (PubChem CID 167425407) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 3-(3,7-dihydroxy-3,7-dimethyloctyl)-2,4-dihydroxy-6-pentylbenzoic acid.
| Compound Name | 3-(3,7-dihydroxy-3,7-dimethyloctyl)-2,4-dihydroxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 167425407 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-(3,7-dihydroxy-3,7-dimethyloctyl)-2,4-dihydroxy-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O)c(CCC(C)(O)CCCC(C)(C)O)c(O)c1C(=O)O |
| InChI | InChI=1S/C22H36O6/c1-5-6-7-9-15-14-17(23)16(19(24)18(15)20(25)26)10-13-22(4,28)12-8-11-21(2,3)27/h14,23-24,27-28H,5-13H2,1-4H3,(H,25,26) |
| InChIKey | ZDARKKXFNKIGTC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|