C16H24N4O5 — CID 167430486
(2,5-dioxopyrrolidin-1-yl) N-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]carbamate (PubChem CID 167430486) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 167430486 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]carbamate |
| SMILES | CN1CCN([C@@H]2CCCC[C@H]2NC(=O)ON2C(=O)CCC2=O)C(=O)C1 |
| InChI | InChI=1S/C16H24N4O5/c1-18-8-9-19(15(23)10-18)12-5-3-2-4-11(12)17-16(24)25-20-13(21)6-7-14(20)22/h11-12H,2-10H2,1H3,(H,17,24)/t11-,12-/m1/s1 |
| InChIKey | MYOFIWWGQOJDHE-VXGBXAGGSA-N |
| XLogP | -0.14 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|