C9H14N4O9S2 — CID 167432372
2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetic acid (PubChem CID 167432372) has the molecular formula C9H14N4O9S2 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetic acid.
| Compound Name | 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetic acid |
|---|---|
| PubChem CID | 167432372 |
| Molecular Formula | C9H14N4O9S2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetic acid |
| SMILES | N/C(=N\S(=O)(=O)CC(=O)O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C9H14N4O9S2/c10-8(11-23(17,18)4-7(14)15)6-2-1-5-3-12(6)9(16)13(5)22-24(19,20)21/h5-6H,1-4H2,(H2,10,11)(H,14,15)(H,19,20,21)/t5-,6+/m1/s1 |
| InChIKey | MBTSWVCRRXGHBG-RITPCOANSA-N |
| XLogP | -2.24 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|