C22H40S15 — CID 167434660
1-[bis[1,2,3,5,6-pentakis(sulfanyl)cycloheptyl]methyl]cycloheptane-1,2,3,5,6-pentathiol (PubChem CID 167434660) has the molecular formula C22H40S15 and a molecular weight of 785.57 g/mol. Its IUPAC name is 1-[bis[1,2,3,5,6-pentakis(sulfanyl)cycloheptyl]methyl]cycloheptane-1,2,3,5,6-pentathiol.
| Compound Name | 1-[bis[1,2,3,5,6-pentakis(sulfanyl)cycloheptyl]methyl]cycloheptane-1,2,3,5,6-pentathiol |
|---|---|
| PubChem CID | 167434660 |
| Molecular Formula | C22H40S15 |
| Molecular Weight | 785.57 g/mol |
| Exact Mass | 783.89 |
| IUPAC Name | 1-[bis[1,2,3,5,6-pentakis(sulfanyl)cycloheptyl]methyl]cycloheptane-1,2,3,5,6-pentathiol |
| SMILES | SC1CC(S)C(S)C(S)(C(C2(S)CC(S)C(S)CC(S)C2S)C2(S)CC(S)C(S)CC(S)C2S)CC1S |
| InChI | InChI=1S/C22H40S15/c23-7-1-10(26)16(32)20(35,4-13(7)29)19(21(36)5-14(30)8(24)2-11(27)17(21)33)22(37)6-15(31)9(25)3-12(28)18(22)34/h7-19,23-37H,1-6H2 |
| InChIKey | WIBMPXGQGYMDEG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|