C7H14S5 — CID 141240027
cycloheptane-1,2,3,5,6-pentathiol (PubChem CID 141240027) has the molecular formula C7H14S5 and a molecular weight of 258.52 g/mol. Its IUPAC name is cycloheptane-1,2,3,5,6-pentathiol.
| Compound Name | cycloheptane-1,2,3,5,6-pentathiol |
|---|---|
| PubChem CID | 141240027 |
| Molecular Formula | C7H14S5 |
| Molecular Weight | 258.52 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | cycloheptane-1,2,3,5,6-pentathiol |
| SMILES | SC1CC(S)C(S)C(S)CC1S |
| InChI | InChI=1S/C7H14S5/c8-3-1-5(10)7(12)6(11)2-4(3)9/h3-12H,1-2H2 |
| InChIKey | VELQNGKCPGQXQS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|