C7H12S2 — CID 98091771
(1S,2S,4R,5R)-bicyclo[2.2.1]heptane-2,5-dithiol (PubChem CID 98091771) has the molecular formula C7H12S2 and a molecular weight of 160.31 g/mol. Its IUPAC name is (1S,2S,4R,5R)-bicyclo[2.2.1]heptane-2,5-dithiol.
| Compound Name | (1S,2S,4R,5R)-bicyclo[2.2.1]heptane-2,5-dithiol |
|---|---|
| PubChem CID | 98091771 |
| Molecular Formula | C7H12S2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (1S,2S,4R,5R)-bicyclo[2.2.1]heptane-2,5-dithiol |
| SMILES | S[C@@H]1C[C@@H]2C[C@@H]1C[C@@H]2S |
| InChI | InChI=1S/C7H12S2/c8-6-2-4-1-5(6)3-7(4)9/h4-9H,1-3H2/t4-,5+,6+,7- |
| InChIKey | ZAKWKQQWRCCBAF-RNGGSSJXSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|