C6H11FS — CID 160810727
cis-(1S,2R)-2-fluorocyclohexane-1-thiol (PubChem CID 160810727) has the molecular formula C6H11FS and a molecular weight of 134.22 g/mol. Its IUPAC name is cis-(1S,2R)-2-fluorocyclohexane-1-thiol.
| Compound Name | cis-(1S,2R)-2-fluorocyclohexane-1-thiol |
|---|---|
| PubChem CID | 160810727 |
| Molecular Formula | C6H11FS |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | cis-(1S,2R)-2-fluorocyclohexane-1-thiol |
| SMILES | F[C@@H]1CCCC[C@@H]1S |
| InChI | InChI=1S/C6H11FS/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | GKYIMQFINBTCQR-RITPCOANSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|