C6H9F3S — CID 146493403
2,4,5-trifluorocyclohexane-1-thiol (PubChem CID 146493403) has the molecular formula C6H9F3S and a molecular weight of 170.20 g/mol. Its IUPAC name is 2,4,5-trifluorocyclohexane-1-thiol.
| Compound Name | 2,4,5-trifluorocyclohexane-1-thiol |
|---|---|
| PubChem CID | 146493403 |
| Molecular Formula | C6H9F3S |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2,4,5-trifluorocyclohexane-1-thiol |
| SMILES | FC1CC(F)C(S)CC1F |
| InChI | InChI=1S/C6H9F3S/c7-3-1-5(9)6(10)2-4(3)8/h3-6,10H,1-2H2 |
| InChIKey | AVZXMCJSVXXLNN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|