C7H14S — CID 22211639
cis-(1S,2R)-2-methylcyclohexane-1-thiol (PubChem CID 22211639) has the molecular formula C7H14S and a molecular weight of 130.26 g/mol. Its IUPAC name is cis-(1S,2R)-2-methylcyclohexane-1-thiol.
| Compound Name | cis-(1S,2R)-2-methylcyclohexane-1-thiol |
|---|---|
| PubChem CID | 22211639 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | cis-(1S,2R)-2-methylcyclohexane-1-thiol |
| SMILES | C[C@@H]1CCCC[C@@H]1S |
| InChI | InChI=1S/C7H14S/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | ICOZZYFCTGILJV-RQJHMYQMSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|