C65H70O7 — CID 167438449
bis[2-(1-hydroxycyclohexyl)-3,4-bis(2,4,6-trimethylbenzoyl)phenyl]methanone (PubChem CID 167438449) has the molecular formula C65H70O7 and a molecular weight of 963.27 g/mol. Its IUPAC name is bis[2-(1-hydroxycyclohexyl)-3,4-bis(2,4,6-trimethylbenzoyl)phenyl]methanone.
| Compound Name | bis[2-(1-hydroxycyclohexyl)-3,4-bis(2,4,6-trimethylbenzoyl)phenyl]methanone |
|---|---|
| PubChem CID | 167438449 |
| Molecular Formula | C65H70O7 |
| Molecular Weight | 963.27 g/mol |
| Exact Mass | 962.51 |
| IUPAC Name | bis[2-(1-hydroxycyclohexyl)-3,4-bis(2,4,6-trimethylbenzoyl)phenyl]methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccc(C(=O)c3ccc(C(=O)c4c(C)cc(C)cc4C)c(C(=O)c4c(C)cc(C)cc4C)c3C3(O)CCCCC3)c(C3(O)CCCCC3)c2C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C65H70O7/c1-35-27-39(5)51(40(6)28-35)60(67)47-19-21-49(57(64(71)23-15-13-16-24-64)55(47)62(69)53-43(9)31-37(3)32-44(53)10)59(66)50-22-20-48(61(68)52-41(7)29-36(2)30-42(52)8)56(58(50)65(72)25-17-14-18-26-65)63(70)54-45(11)33-38(4)34-46(54)12/h19-22,27-34,71-72H,13-18,23-26H2,1-12H3 |
| InChIKey | QECPUHXFMCDDIH-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.27 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |