C15H16N2O4 — CID 167439219
3-(2,5-dihydroxy-3-phenyl-2,5-dihydropyrrol-1-yl)piperidine-2,6-dione (PubChem CID 167439219) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3-phenyl-2,5-dihydropyrrol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(2,5-dihydroxy-3-phenyl-2,5-dihydropyrrol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167439219 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-(2,5-dihydroxy-3-phenyl-2,5-dihydropyrrol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(O)C=C(c3ccccc3)C2O)C(=O)N1 |
| InChI | InChI=1S/C15H16N2O4/c18-12-7-6-11(14(20)16-12)17-13(19)8-10(15(17)21)9-4-2-1-3-5-9/h1-5,8,11,13,15,19,21H,6-7H2,(H,16,18,20) |
| InChIKey | LBXLGXGWXOJWFO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|