C19H37NO7 — CID 167448183
propan-2-yl 3-[[[2-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]acetyl]amino]methoxy]propanoate (PubChem CID 167448183) has the molecular formula C19H37NO7 and a molecular weight of 391.51 g/mol. Its IUPAC name is propan-2-yl 3-[[[2-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]acetyl]amino]methoxy]propanoate.
| Compound Name | propan-2-yl 3-[[[2-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]acetyl]amino]methoxy]propanoate |
|---|---|
| PubChem CID | 167448183 |
| Molecular Formula | C19H37NO7 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | propan-2-yl 3-[[[2-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]acetyl]amino]methoxy]propanoate |
| SMILES | CCC(C)CCOCCOCCOCC(=O)NCOCCC(=O)OC(C)C |
| InChI | InChI=1S/C19H37NO7/c1-5-17(4)6-8-23-10-11-24-12-13-25-14-18(21)20-15-26-9-7-19(22)27-16(2)3/h16-17H,5-15H2,1-4H3,(H,20,21) |
| InChIKey | UNVFUXIHLZMMCC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|