C19H24N6O2 — CID 167457413
N-[1-[5-[(6-aminopyrimidin-4-yl)amino]-2,3-dimethyl-6-oxo-1-pyridinyl]-5-methylcyclohex-2-en-1-yl]formamide (PubChem CID 167457413) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[1-[5-[(6-aminopyrimidin-4-yl)amino]-2,3-dimethyl-6-oxo-1-pyridinyl]-5-methylcyclohex-2-en-1-yl]formamide.
| Compound Name | N-[1-[5-[(6-aminopyrimidin-4-yl)amino]-2,3-dimethyl-6-oxo-1-pyridinyl]-5-methylcyclohex-2-en-1-yl]formamide |
|---|---|
| PubChem CID | 167457413 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[1-[5-[(6-aminopyrimidin-4-yl)amino]-2,3-dimethyl-6-oxo-1-pyridinyl]-5-methylcyclohex-2-en-1-yl]formamide |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n(C2(NC=O)C=CCC(C)C2)c1C |
| InChI | InChI=1S/C19H24N6O2/c1-12-5-4-6-19(9-12,23-11-26)25-14(3)13(2)7-15(18(25)27)24-17-8-16(20)21-10-22-17/h4,6-8,10-12H,5,9H2,1-3H3,(H,23,26)(H3,20,21,22,24) |
| InChIKey | IDKQQLWNRYHOIH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|